CymitQuimica logo

CAS 20556-14-3

:

L-Valyl-L-isoleucine

Description:
L-Valyl-L-isoleucine, with the CAS number 20556-14-3, is a dipeptide composed of the amino acids valine and isoleucine. It is characterized by its specific sequence, where valine is linked to isoleucine through a peptide bond. This compound is typically found in protein structures and can play a role in various biological processes, including protein synthesis and metabolism. L-Valyl-L-isoleucine is known for its hydrophobic properties due to the branched-chain nature of both constituent amino acids, which can influence its solubility and interaction with other biomolecules. It may also exhibit specific biological activities, such as influencing muscle metabolism or acting as a signaling molecule. In terms of stability, dipeptides like L-Valyl-L-isoleucine are generally stable under physiological conditions but can be susceptible to hydrolysis in the presence of strong acids or bases. Overall, this compound is of interest in biochemistry and nutrition, particularly in studies related to protein structure and function.
Formula:C11H22N2O3
InChI:InChI=1/C11H22N2O3/c1-5-7(4)9(11(15)16)13-10(14)8(12)6(2)3/h6-9H,5,12H2,1-4H3,(H,13,14)(H,15,16)/t7?,8-,9-/m0/s1
InChI key:PNVLWFYAPWAQMU-CIUDSAMLSA-N
SMILES:CCC(C)[C@@H](C(=O)O)N=C([C@H](C(C)C)N)O
Synonyms:
  • H-Val-Ile-OH
Found 6 products.