CymitQuimica logo

CAS 20583-66-8

:

1,1,1,5,5,6,6,7,7,7-decafluoro-2,4-heptanedione

Description:
1,1,1,5,5,6,6,7,7,7-decafluoro-2,4-heptanedione is a fluorinated organic compound characterized by its unique structure, which includes multiple fluorine atoms attached to a heptanedione backbone. This compound features two carbonyl (C=O) functional groups, contributing to its reactivity and potential applications in various chemical processes. The presence of fluorine atoms imparts distinctive properties, such as increased thermal stability, hydrophobicity, and altered solubility compared to non-fluorinated analogs. It is typically a colorless to pale yellow liquid at room temperature and may exhibit low volatility. The compound is of interest in fields such as materials science, pharmaceuticals, and agrochemicals due to its potential as a building block for more complex fluorinated molecules. Additionally, its unique electronic properties can influence its behavior in chemical reactions, making it a subject of study in synthetic organic chemistry. Safety precautions should be taken when handling this compound, as fluorinated substances can pose environmental and health risks.
Formula:C7H2F10O2
InChI:InChI=1/C7H2F10O2/c8-4(9,6(13,14)7(15,16)17)2(18)1-3(19)5(10,11)12/h1H2
InChI key:SUORUQZBFOQDGX-UHFFFAOYSA-N
SMILES:C(C(=O)C(C(C(F)(F)F)(F)F)(F)F)C(=O)C(F)(F)F
Synonyms:
  • 1,1,1,5,5,6,6,7,7,7-Decafluoroheptane-2,4-Dione
Found 4 products.