CymitQuimica logo

CAS 205873-26-3

:

(1S,2S)-N,N'-dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]ethane-1,2-diaminium

Description:
(1S,2S)-N,N'-dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]ethane-1,2-diaminium is a chemical compound characterized by its complex structure, which includes two dimethylamino groups and two trifluoromethyl-substituted phenyl rings. This compound is typically a quaternary ammonium salt, indicating that it carries a positive charge due to the presence of the ammonium groups. The trifluoromethyl groups contribute to its hydrophobicity and can enhance the compound's biological activity and lipophilicity. The stereochemistry of the compound, denoted by the (1S,2S) configuration, suggests specific spatial arrangements that can influence its reactivity and interactions with biological systems. This compound may exhibit properties such as solubility in organic solvents, potential antimicrobial activity, and utility in various applications, including pharmaceuticals and materials science. Its unique characteristics stem from the combination of the bulky trifluoromethyl groups and the dimethylamino functionalities, which can affect its behavior in different chemical environments.
Formula:C18H20F6N2
InChI:InChI=1/C18H18F6N2/c1-25-15(11-5-3-7-13(9-11)17(19,20)21)16(26-2)12-6-4-8-14(10-12)18(22,23)24/h3-10,15-16,25-26H,1-2H3/p+2/t15-,16-/m0/s1
InChI key:SBGOGHODWUZHIY-HOTGVXAUSA-N
SMILES:CN[C@@H](C1=CC(=CC=C1)C(F)(F)F)[C@H](C2=CC(=CC=C2)C(F)(F)F)NC
Found 4 products.