CymitQuimica logo

CAS 20601-85-8

:

[1,1'-Biphenyl]-2,2'-diol, 5,5'-dipropyl-

Description:
[1,1'-Biphenyl]-2,2'-diol, 5,5'-dipropyl- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of hydroxyl (-OH) groups at the 2 and 2' positions of the biphenyl framework indicates that it is a diol, specifically a diphenolic compound. The additional dipropyl groups at the 5 and 5' positions contribute to its hydrophobic character and influence its solubility and physical properties. This compound may exhibit interesting chemical reactivity due to the presence of the hydroxyl groups, which can participate in hydrogen bonding and may affect its interactions with other molecules. It is important to note that compounds like this can have applications in various fields, including materials science and organic synthesis. However, specific properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise information.
Formula:C18H22O2
InChI:InChI=1S/C18H20O4/c1-2-3-14-10-13(5-7-17(14)21)16-9-12(4-6-18(16)22)8-15(20)11-19/h2,4-7,9-10,15,19-22H,1,3,8,11H2
InChI key:LHJCLTLPXXKFTJ-UHFFFAOYSA-N
SMILES:C=CCC1=C(C=CC(=C1)C2=C(C=CC(=C2)CC(CO)O)O)O
Found 5 products.