CAS 20605-40-7
:Benzenecarbothioic acid, hydrazide
Description:
Benzenecarbothioic acid, hydrazide, also known as benzothiohydrazide, is an organic compound characterized by the presence of a hydrazide functional group attached to a benzene ring and a thioic acid moiety. Its molecular structure features a hydrazine (-NH-NH2) group linked to a carbonyl carbon that is also bonded to a thiol (-SH) group, making it a thiohydrazide. This compound is typically a white to off-white solid and is soluble in polar solvents. It exhibits properties such as potential reactivity with electrophiles due to the presence of the hydrazide group, which can participate in various chemical reactions, including condensation and substitution reactions. Benzenecarbothioic acid, hydrazide may also display biological activity, making it of interest in pharmaceutical and agrochemical research. Safety data indicates that, like many hydrazine derivatives, it should be handled with care due to potential toxicity and reactivity. Proper storage and handling procedures are essential to ensure safety when working with this compound.
Formula:C7H8N2S
InChI:InChI=1S/C7H8N2S/c8-9-7(10)6-4-2-1-3-5-6/h1-5H,8H2,(H,9,10)
InChI key:InChIKey=PNALOBAQBMAHBZ-UHFFFAOYSA-N
SMILES:C(NN)(=S)C1=CC=CC=C1
Synonyms:- Benzenecarbothioic acid, hydrazide
- Benzoic acid, thio-, hydrazide
- Benzoicacid, thio-, hydrazide (7CI,8CI)
- Thiobenzhydrazide
- Thiobenzohydrazide
- Thiobenzoic acid hydrazide
- Thiobenzoic hydrazide
- Thiobenzoylhydrazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzenecarbothioic acid, hydrazide
CAS:Formula:C7H8N2SPurity:95%Color and Shape:SolidMolecular weight:152.2168Benzothiohydrazide
CAS:Benzothiohydrazide is an analog of isoniazid with anti-tuberculosis activity and can be used to isolate fungi and bacteria.Formula:C7H8N2SPurity:98%Color and Shape:SolidMolecular weight:152.22N-Aminobenzenecarbothioamide
CAS:N-Aminobenzenecarbothioamide is a chemical compound that is stable in hydrochloric acid and carbon disulphide. It has been shown to inhibit the growth of skin cells by binding to epidermal growth factor. It also inhibits the production of inflammatory bowel disease, which may be due to its ability to inhibit nitro and nitrite ion. The antimicrobial activity of N-aminobenzenecarbothioamide has not been studied.
Formula:C7H8N2SPurity:Min. 95%Molecular weight:152.22 g/mol




