CAS 2061-46-3
:(3beta)-17-ethynyl-3-hydroxyestr-4-en-17-yl acetate
Description:
The chemical substance known as (3beta)-17-ethynyl-3-hydroxyestr-4-en-17-yl acetate, with the CAS number 2061-46-3, is a synthetic derivative of estrogen, specifically a modified form of estradiol. This compound features an ethynyl group at the 17 position and an acetate group at the hydroxyl position, which enhances its oral bioavailability and metabolic stability compared to natural estrogens. It exhibits estrogenic activity, making it useful in various therapeutic applications, particularly in hormone replacement therapy and contraceptive formulations. The structural modifications contribute to its potency and selectivity for estrogen receptors, influencing various physiological processes such as reproductive health, bone density maintenance, and regulation of the menstrual cycle. Additionally, its pharmacokinetic properties allow for effective absorption and distribution within the body, making it a significant compound in endocrinology and gynecology. As with many synthetic hormones, careful consideration of dosage and potential side effects is essential in clinical use.
Formula:C22H30O3
InChI:InChI=1/C22H30O3/c1-4-22(25-14(2)23)12-10-20-19-7-5-15-13-16(24)6-8-17(15)18(19)9-11-21(20,22)3/h1,13,16-20,24H,5-12H2,2-3H3/t16-,17-,18+,19+,20-,21-,22?/m0/s1
InChI key:WJCWCFAFTXVJQT-KAKDVIIHSA-N
SMILES:CC(=O)O[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C[C@H](CC[C@H]34)O)C)C#C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
19-Norpregn-4-en-20-yne-3,17-diol, 17-acetate, (3β,17α)-
CAS:Formula:C22H30O3Color and Shape:SolidMolecular weight:342.4718Ethynodiol-17-Acetate
CAS:Formula:C22H30O3Color and Shape:White To Off-White SolidMolecular weight:342.48Norethynodiol 17-Monoacetate
CAS:Controlled ProductApplications Norethynodiol 17-Monoacetate is a steroidal progestin and is used in the synthesis of cyclopentylpropionic ester of norethisterol acetate which works as a long-acting contraceptive.
References Chen, W., et al.: Yaoxue Xuebao, 19, 935 (1984)Formula:C22H30O3Color and Shape:NeatMolecular weight:342.47




