CymitQuimica logo

CAS 20610-77-9

:

4-Aminobenzoic acid 4-aminophenyl ester

Description:
4-Aminobenzoic acid 4-aminophenyl ester, also known as para-aminobenzoic acid phenyl ester, is an organic compound characterized by its ester functional group derived from para-aminobenzoic acid and an aniline derivative. This compound typically appears as a white to off-white solid and is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water. It possesses both amino and ester functional groups, which contribute to its reactivity and potential applications in various fields, including pharmaceuticals and organic synthesis. The presence of the amino group allows for hydrogen bonding, influencing its physical properties and interactions with other molecules. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 4-aminobenzoic acid 4-aminophenyl ester serves as a versatile building block in organic chemistry and may have implications in drug development and other applications.
Formula:C13H12N2O2
InChI:InChI=1S/C13H12N2O2/c14-10-3-1-9(2-4-10)13(16)17-12-7-5-11(15)6-8-12/h1-8H,14-15H2
InChI key:LOCTYHIHNCOYJZ-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(=O)OC2=CC=C(C=C2)N)N
Synonyms:
  • Apab
  • 4-Aminophenyl 4-aminobenzoate
  • 4'-Aminophenyl 4-Aminobenzoate (Apab)
Found 4 products.