CAS 2065228-60-4

Formula: C23H37NO7

InChI: InChI=1S/C23H37NO7/c1-4-24-9-20(10-25)6-5-13(26)23-18(20)16(31-3)14(19(23)24)21(28)8-12(30-2)11-7-22(23,29)17(21)15(11)27/h11-19,25-29H,4-10H2,1-3H3/t11-,12+,13+,14+,15+,16+,17-,18-,19-,20+,21+,22+,23+/m1/s1

InChI key: IVNCQHJFFGCDLK-YLDGKFAESA-N

SMILES: CCN1C[C@@]2(CC[C@@H]([C@]34[C@@H]2[C@H]([C@@H]([C@H]31)[C@]5(C[C@@H]([C@H]6C[C@@]4([C@@H]5[C@H]6O)O)OC)O)OC)O)CO

Carmichaenine B

CAS: 2065228-60-4

Carmichaenine B

Molecular weight: 439.26

Ref: 10-F566450

Carmichaenine B

CAS: 2065228-60-4

Carmichaenine B is a natiral product from Aconitum carmichaeli.

Formula: C₂₃H₃₇NO₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 439.549

Ref: TM-TN3597

Carmichaenine B

Controlled Product

CAS: 2065228-60-4

Carmichaenine B is an alkaloid compound, which is derived from the plant species of the Menispermaceae family. This natural product is primarily isolated from traditional medicinal plants and exhibits a variety of biological activities. The mode of action is believed to involve interaction with specific molecular targets within cellular pathways, potentially influencing biochemical activities such as enzyme inhibition or receptor modulation.

Formula: C₂₃H₃₇NO₇

Purity: Min. 95%

Molecular weight: 439.5 g/mol

Ref: 3D-QHD22860