CAS 2065228-62-6

Formula: C29H39NO7

InChI: InChI=1S/C29H39NO7/c1-3-30-13-27(14-31)10-9-19(32)29-17-11-16-18(36-2)12-28(35,21(25(29)30)22(33)24(27)29)20(17)23(16)37-26(34)15-7-5-4-6-8-15/h4-8,16-25,31-33,35H,3,9-14H2,1-2H3/t16-,17-,18+,19+,20-,21+,22+,23+,24-,25-,27+,28-,29+/m1/s1

InChI key: DGKLDJINLBMVKG-WJQURREQSA-N

SMILES: CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]2[C@H]([C@@H]([C@H]31)[C@]5(C[C@@H]([C@H]6C[C@@H]4[C@@H]5[C@H]6OC(=O)C7=CC=CC=C7)OC)O)O)O)CO

Carmichaenine D

CAS: 2065228-62-6

Carmichaenine D

Molecular weight: 513.27

Ref: 10-F566452

Carmichaenine D

CAS: 2065228-62-6

Carmichaenine D is a natiral product from Aconitum carmichaeli.

Formula: C₂₉H₃₉NO₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 513.631

Ref: TM-TN3599

Carmichaenine D

CAS: 2065228-62-6

Carmichaenine D is a natural alkaloid, which is derived from specific plant species known for their rich phytochemical profiles. This compound is primarily sourced from the roots of plants belonging to the genus Aconitum, a group well-recognized in traditional medicine systems for their diverse bioactive constituents.

Formula: C₂₉H₃₉NO₇

Purity: Min. 95%

Molecular weight: 513.6 g/mol

Ref: 3D-QHD22862