CymitQuimica logo

CAS 206559-36-6

:

3-Benzyloxyphenyl isothiocyanate

Description:
3-Benzyloxyphenyl isothiocyanate is an organic compound characterized by the presence of an isothiocyanate functional group (-N=C=S) attached to a phenyl ring that is further substituted with a benzyloxy group. This compound typically appears as a yellow to brown solid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the electrophilic nature of the isothiocyanate group. It is often utilized in organic synthesis and medicinal chemistry, particularly in the development of bioactive compounds. The benzyloxy substituent can enhance the compound's solubility and stability, making it useful in various applications, including as a potential precursor in the synthesis of more complex molecules. Additionally, isothiocyanates are recognized for their biological activities, including potential anticancer properties, which makes compounds like 3-Benzyloxyphenyl isothiocyanate of interest in pharmaceutical research. Safety precautions should be observed when handling this compound, as isothiocyanates can be irritants and may pose health risks.
Formula:C14H11NOS
InChI:InChI=1/C14H11NOS/c17-11-15-13-7-4-8-14(9-13)16-10-12-5-2-1-3-6-12/h1-9H,10H2
InChI key:QJLFNDXMZQJMDL-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COc1cccc(c1)N=C=S
Synonyms:
  • 1-(Benzyloxy)-3-Isothiocyanatobenzene
Found 5 products.