CAS 20665-63-8

Furan-2,5-d2,tetrahydro-2,5-d2- (6CI,8CI,9CI)

Description:

Furan-2,5-d2, tetrahydro-2,5-d2 (CAS 20665-63-8) is a deuterated derivative of furan, a five-membered aromatic heterocyclic compound containing oxygen. The "d2" notation indicates that two hydrogen atoms in the furan structure have been replaced with deuterium, a stable isotope of hydrogen. This modification can influence the compound's physical and chemical properties, such as its reactivity and spectroscopic characteristics. Furan itself is known for its distinctive sweet odor and is used in various chemical syntheses, including the production of pharmaceuticals and agrochemicals. The tetrahydro form refers to the fully saturated version of furan, which can exhibit different stability and reactivity compared to its unsaturated counterpart. Deuterated compounds like furan-2,5-d2 are often utilized in NMR spectroscopy and other analytical techniques due to their unique spectral signatures, which can aid in studying reaction mechanisms and molecular dynamics. Overall, furan-2,5-d2 serves as a valuable tool in both research and industrial applications.

Formula: C₄H₄D₄O

InChI: InChI=1S/C4H8O/c1-2-4-5-3-1/h1-4H2/i3D2,4D2

InChI key: WYURNTSHIVDZCO-KHORGVISSA-N

SMILES: [2H]C1(CCC(O1)([2H])[2H])[2H]

Synonyms:

• Tetrahydrofuran-2,2,5,5-D4

Tetrahydrofuran-2,2,5,5-d4

CAS: 109-99-9, 20665-63-8

Purity: 99 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 76.13

Ref: 3U-D6722

Tetrahydrofuran-2,2,5,5-d4

Controlled Product

CAS: 20665-63-8

Applications Tetrahydrofuran-2,2,5,5-d4 (CAS# 20665-63-8) is a useful isotopically labeled research compound.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₄D₄H₄O

Color and Shape: Neat

Molecular weight: 76.13

Ref: TR-T293519