CymitQuimica logo

CAS 20680-59-5

:

3-Methylbenzenecarboximidamide hydrochloride

Description:
3-Methylbenzenecarboximidamide hydrochloride, with the CAS number 20680-59-5, is a chemical compound characterized by its structure, which includes a methyl group attached to a benzene ring and an amidine functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in various chemical applications. The presence of the carboximidamide group contributes to its potential as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its hydrochloride salt form enhances its stability and solubility, facilitating its use in biological and chemical research. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled. Overall, 3-Methylbenzenecarboximidamide hydrochloride is notable for its unique structural features and potential applications in synthetic chemistry.
Formula:C8H11ClN2
InChI:InChI=1/C8H10N2.ClH/c1-6-3-2-4-7(5-6)8(9)10;/h2-5H,1H3,(H3,9,10);1H
InChI key:QEAXZIMXYPAZAX-UHFFFAOYSA-N
SMILES:Cc1cccc(c1)C(=N)N.Cl
Synonyms:
  • 3-Methylbenzenecarboximidamide hydrochloride (1:1)
  • Benzenecarboximidamide, 3-Methyl-, Hydrochloride (1:1)
  • Amino(3-Methylphenyl)Methaniminium Chloride
Found 4 products.