CymitQuimica logo

CAS 2071192-58-8

:

1,1-Dimethylethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-piperidinecarboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring and a boron-containing dioxaborolane moiety. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of various pharmaceuticals or agrochemicals. Its molecular structure suggests it possesses both hydrophobic and hydrophilic characteristics, which can influence its solubility and reactivity in different environments. The presence of the boron atom in the dioxaborolane group indicates potential applications in boron chemistry, including its use in cross-coupling reactions. Additionally, the dimethyl groups contribute to steric hindrance, which can affect the compound's reactivity and interaction with other molecules. Overall, this compound exemplifies the intricate design often found in synthetic organic chemistry, where specific functional groups are strategically incorporated to achieve desired chemical properties and reactivity profiles.
Formula:C16H30BNO4
InChI:InChI=1S/C16H30BNO4/c1-14(2,3)20-13(19)18-11-9-8-10-12(18)17-21-15(4,5)16(6,7)22-17/h12H,8-11H2,1-7H3
InChI key:InChIKey=YLTQCJDLGHTJDE-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C(CCCC1)B2OC(C)(C)C(C)(C)O2
Synonyms:
  • 1-Piperidinecarboxylic acid, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-piperidinecarboxylate
Found 5 products.