CAS 207122-16-5: 2,2′,3,4,4′,5′,6-Heptabromodiphenyl ether
Description:2,2′,3,4,4′,5′,6-Heptabromodiphenyl ether, with the CAS number 207122-16-5, is a brominated flame retardant belonging to the class of diphenyl ethers. This compound is characterized by the presence of seven bromine atoms attached to the diphenyl ether structure, which significantly enhances its flame-retardant properties. It is typically used in various applications, including plastics, textiles, and electronic devices, to reduce flammability. The high bromine content contributes to its effectiveness in preventing ignition and slowing down the spread of fire. However, due to environmental and health concerns associated with brominated flame retardants, including potential persistence in the environment and bioaccumulation, regulatory scrutiny has increased. Studies have indicated that such compounds may pose risks to human health and ecosystems, leading to restrictions in some regions. As a result, ongoing research is focused on understanding its environmental fate, toxicity, and potential alternatives that are safer and more sustainable.
Formula:C12H3Br7O
InChI:InChI=1S/C12H3Br7O/c13-4-1-6(15)9(3-5(4)14)20-12-8(17)2-7(16)10(18)11(12)19/h1-3H
InChI key:InChIKey=ILPSCQCLBHQUEM-UHFFFAOYSA-N
SMILES:BrC=1C=C(Br)C(OC=2C(Br)=CC(Br)=C(Br)C2Br)=CC1Br
- Synonyms:
- 2,2′,3,4,4′,5′,6-Heptabromodiphenyl ether
- 2,3,4,6-Tetrabromophenyl 2,4,5-Tribromophenyl Ether
- Bde 183
- Benzene, 1,2,3,5-Tetrabromo-4-(2,4,5-Tribromophenoxy)-
- Pbde 183
- 1,2,3,5-Tetrabromo-4-(2,4,5-tribromophenoxy)benzene
