CymitQuimica logo

CAS 20716-26-1

:

Benzenepropanol, 2-nitro-

Description:
Benzenepropanol, 2-nitro- is an organic compound characterized by its structure, which includes a benzene ring, a propanol group, and a nitro substituent at the second position of the propanol chain. This compound typically exhibits properties common to nitro-substituted aromatic compounds, such as being a colorless to pale yellow liquid with a distinctive odor. It is likely to be soluble in organic solvents but may have limited solubility in water due to the hydrophobic nature of the benzene ring. The presence of the nitro group can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic aromatic substitution. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical or agrochemical applications. Safety data should be consulted, as nitro compounds can sometimes be hazardous, and appropriate handling precautions should be taken. Overall, Benzenepropanol, 2-nitro- represents a versatile compound in organic synthesis and research.
Formula:C9H11NO3
InChI:InChI=1S/C9H11NO3/c11-7-3-5-8-4-1-2-6-9(8)10(12)13/h1-2,4,6,11H,3,5,7H2
InChI key:LJHJJGAQQGSPRL-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)CCCO)[N+](=O)[O-]
Synonyms:
  • 3-(2-Nitro-Phenyl)-Propan-1-ol
Found 4 products.