CAS 20723-84-6

2-methoxyphenyl 2-(biphenyl-4-yl)butanoate

Description:

2-Methoxyphenyl 2-(biphenyl-4-yl)butanoate, with the CAS number 20723-84-6, is an organic compound characterized by its ester functional group, which is formed from the reaction of a carboxylic acid and an alcohol. This compound features a butanoate moiety, indicating a four-carbon chain, and is substituted with a methoxy group on one aromatic ring and a biphenyl group on the other. The presence of these aromatic systems contributes to its potential for various applications, including in pharmaceuticals and materials science. The methoxy group enhances solubility and reactivity, while the biphenyl structure can influence the compound's electronic properties and stability. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure, which can be further explored through experimental characterization.

Formula: C₂₃H₂₂O₃

InChI: InChI=1/C23H22O3/c1-3-20(23(24)26-22-12-8-7-11-21(22)25-2)19-15-13-18(14-16-19)17-9-5-4-6-10-17/h4-16,20H,3H2,1-2H3

InChI key: HSCJXYVNGVOWMN-UHFFFAOYSA-N

SMILES: CCC(C1=CC=C(C=C1)C2=CC=CC=C2)C(=O)OC3=CC=CC=C3OC

[1,1'-Biphenyl]-4-acetic acid, α-ethyl-, 2-methoxyphenyl ester

CAS: 20723-84-6

Formula: C₂₃H₂₂O₃

Molecular weight: 346.419

Ref: IN-DA002IXC