CymitQuimica logo

CAS 207447-27-6

:

9-(4'-iodo-[1,1'-biphenyl]-4-yl)-9H-carbazole

Description:
9-(4'-Iodo-[1,1'-biphenyl]-4-yl)-9H-carbazole, with the CAS number 207447-27-6, is an organic compound characterized by its complex structure, which includes a carbazole core substituted with a 4-iodo-1,1'-biphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including high thermal stability and potential for strong π-π stacking interactions due to its extended conjugated system. The presence of the iodine atom enhances its electronic properties, making it useful in various applications such as organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics. Additionally, the compound may display interesting photophysical properties, including fluorescence, which can be influenced by the substituents on the biphenyl moiety. Its solubility and reactivity can vary based on the solvent and conditions, making it a subject of interest in materials science and organic synthesis. Overall, this compound's unique structural features contribute to its potential utility in advanced technological applications.
Formula:C24H16IN
InChI:InChI=1S/C24H16IN/c25-19-13-9-17(10-14-19)18-11-15-20(16-12-18)26-23-7-3-1-5-21(23)22-6-2-4-8-24(22)26/h1-16H
InChI key:HPRNFQUWRYTMIB-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)C5=CC=C(C=C5)I
Synonyms:
  • 9-(4'-iodo-[1,1'-biphenyl]-4-yl)-9H-carbazole
  • 9H-Carbazole, 9-(4'-iodo[1,1'-biphenyl]-4-yl)-
Found 2 products.