CymitQuimica logo

CAS 207456-83-5

:

mesityl-D10 oxide

Description:
Mesityl-D10 oxide, with the CAS number 207456-83-5, is a deuterated derivative of mesityl oxide, which is a ketone characterized by its unique structure and properties. This compound features a five-membered ring structure with three methyl groups attached to a central carbonyl group, and the deuteration indicates that hydrogen atoms in the molecule have been replaced with deuterium, a heavier isotope of hydrogen. This modification can enhance the compound's stability and alter its physical properties, making it useful in various applications, particularly in research and analytical chemistry. Mesityl-D10 oxide is typically colorless and exhibits a distinctive odor, similar to that of its non-deuterated counterpart. Its deuterated nature makes it valuable in NMR spectroscopy and other analytical techniques, allowing for the study of reaction mechanisms and molecular dynamics. Additionally, due to its ketone functional group, it may participate in various chemical reactions, including condensation and oxidation processes. Overall, mesityl-D10 oxide serves as an important tool in both synthetic and analytical chemistry.
Formula:C6D10O
InChI:InChI=1/C6H10O/c1-5(2)4-6(3)7/h4H,1-3H3/i1D3,2D3,3D3,4D
InChI key:SHOJXDKTYKFBRD-LSURFNHSSA-N
SMILES:C(C(=C(C(=O)C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])([2H])([2H])[2H]
Synonyms:
  • 4-(2H3)methyl(2H7)pent-3-en-2-one
Found 2 products.