CAS 20753-28-0

Dibutoxybis[ethyl 3-(oxo-κO)butanoato-κO′]titanium

Description:

Dibutoxybis[ethyl 3-(oxo-κO)butanoato-κO′]titanium, with CAS number 20753-28-0, is a titanium-based coordination compound characterized by its complex structure involving titanium coordinated with butoxy and ethyl 3-(oxo)butanoate ligands. This compound typically exhibits properties associated with titanium alkoxides, such as solubility in organic solvents and potential reactivity with moisture, which can lead to hydrolysis. The presence of butoxy groups contributes to its stability and solubility, while the ethyl 3-(oxo)butanoate moieties may impart specific reactivity, particularly in organic synthesis or catalysis. The compound is likely to be of interest in materials science and organic synthesis due to its potential applications in the formation of titanium-containing polymers or as a precursor in the synthesis of titanium oxide materials. Its behavior in various chemical environments, including thermal stability and reactivity with other reagents, would be essential for understanding its practical applications. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₂₀H₃₆O₈Ti

InChI: InChI=1S/2C6H9O3.2C4H9O.Ti/c2*1-3-9-6(8)4-5(2)7;2*1-2-3-4-5;/h2*4H,3H2,1-2H3;2*2-4H2,1H3;/q4*-1;+4

InChI key: InChIKey=LLMNREONPCSHOD-UHFFFAOYSA-N

SMILES: [O-](CCCC)[Ti+4]12([O-]CCCC)(O=C(OCC)[CH-]C(C)=O1)O=C(OCC)[CH-]C(C)=O2

Synonyms:

• Butanoic acid, 3-oxo-, ethyl ester, titanium complex
• Titanium, dibutoxybis[ethyl 3-(oxo-κO)butanoato-κO′]-
• Dibutoxybis[ethyl 3-(oxo-κO)butanoato-κO′]titanium
• Titanium, dibutoxybis(hydrogen acetoacetato)-, diethyl ester
• Titanium, dibutoxybis(ethyl 3-oxobutanoato-O1′,O3)-

Titanium, dibutoxybis[ethyl 3-(oxo-κO)butanoato-κO']-

CAS: 20753-28-0

Formula: C₂₀H₃₆O₈Ti

Molecular weight: 452.362

Ref: IN-DA002J45