CymitQuimica logo

CAS 2077-19-2

:

2-(4-BROMOPHENYL)PROPAN-2-OL

Description:
2-(4-Bromophenyl)propan-2-ol, with the CAS number 2077-19-2, is an organic compound characterized by its structure, which features a bromophenyl group attached to a tertiary alcohol. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the bromophenyl moiety. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The tertiary alcohol functional group contributes to its ability to participate in various chemical reactions, such as nucleophilic substitutions and eliminations. Additionally, 2-(4-bromophenyl)propan-2-ol may exhibit specific physical properties, including boiling and melting points, which are influenced by its molecular weight and structure. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate personal protective equipment should be used.
Formula:C9H11BrO
InChI:InChI=1S/C9H11BrO/c1-9(2,11)7-3-5-8(10)6-4-7/h3-6,11H,1-2H3
InChI key:AOGYBHJTXLXRSM-UHFFFAOYSA-N
SMILES:CC(C)(C1=CC=C(C=C1)Br)O
Found 6 products.