CAS 20776-51-6
:2-Amino-3-bromobenzoic acid
Description:
2-Amino-3-bromobenzoic acid, with the CAS number 20776-51-6, is an aromatic amino acid derivative characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a benzene ring that also features a bromine atom at the meta position relative to the amino group. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of the bromine atom introduces unique reactivity and can influence the compound's biological activity, making it of interest in pharmaceutical and chemical research. Its molecular structure allows for potential applications in the synthesis of various organic compounds and as an intermediate in the production of dyes, agrochemicals, and pharmaceuticals. Additionally, the compound's properties, such as melting point and boiling point, can vary based on purity and environmental conditions, making it essential to refer to specific data sheets for precise information.
Formula:C7H6BrNO2
InChI:InChI=1S/C7H6BrNO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,9H2,(H,10,11)
InChI key:InChIKey=SRIZNTFPBWRGPB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C(Br)=CC=C1
Synonyms:- 2-Amino-3-Bromobenzoate
- 3-Bromo-2-aminobenzoic acid
- 3-Bromoanthranilic acid
- Anthranilic acid, 3-bromo-
- Benzoic acid, 2-amino-3-bromo-
- NSC 112517
- Zr Be Fvq
- 2-Amino-3-bromobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Amino-3-bromobenzoic acid, 97%
CAS:Used as pharmaceutical intermediates. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a parFormula:C7H5BrNO2Purity:97%Molecular weight:215.032-Amino-3-bromobenzoic acid
CAS:2-Amino-3-bromobenzoic acidFormula:C7H6BrNO2Purity:90%Color and Shape:SolidMolecular weight:216.03204Benzoic acid, 2-amino-3-bromo-
CAS:Formula:C7H6BrNO2Purity:98%Color and Shape:SolidMolecular weight:216.0320Ref: IN-DA002J9K
1g22.00€5g27.00€10g34.00€25g59.00€50g82.00€100g121.00€250g182.00€500g319.00€1kg561.00€5kg2,312.00€10kg4,389.00€2-Amino-3-bromobenzoic acid
CAS:2-Amino-3-bromobenzoic acidFormula:C7H6BrNO2Purity:97%Molecular weight:216.032-Amino-3-bromobenzoic acid
CAS:2-Amino-3-bromobenzoic acidFormula:C7H6BrNO2Purity:97%Color and Shape:SolidMolecular weight:216.032042-Amino-3-bromobenzoic Acid
CAS:Formula:C7H6BrNO2Purity:>98.0%(HPLC)Color and Shape:White to Yellow to Green powder to crystalMolecular weight:216.032-Amino-3-bromobenzoic acid
CAS:2-Amino-3-bromobenzoic acid is a potent inhibitor of the dehydrogenase enzyme. It binds to the active site of the enzyme and prevents it from catalyzing chemical reactions with other molecules. 2-Amino-3-bromobenzoic acid has been shown to bind to dehydrogenases of both the NADH and NADPH type, with IC50 values in the low micromolar range. The crystal structure of 2-amino-3-bromobenzoic acid bound to one conformer of the enzyme has been determined.
2-Amino-3-bromobenzoic acid is not biologically active on its own; it must be converted into an active form by metabolic enzymes before it can inhibit the dehydrogenase enzyme.Formula:C7H6BrNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:216.03 g/mol2-Amino-3-bromo-benzoic acid
CAS:Formula:C7H6BrNO2Purity:97%Color and Shape:SolidMolecular weight:216.034






