CymitQuimica logo

CAS 207910-90-5

:

Benzenepropanoic acid, 3-broMo-.alpha.-oxo-

Description:
Benzenepropanoic acid, 3-bromo-α-oxo- is an organic compound characterized by its aromatic structure and the presence of both a carboxylic acid and a ketone functional group. The compound features a bromine atom substituted at the third position of the benzene ring, which influences its reactivity and physical properties. Typically, such compounds exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic ring contributes to hydrophobic characteristics. The presence of the α-oxo group indicates that it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its potential biological activity. Additionally, the bromine substituent can serve as a useful handle for further functionalization, making it a versatile intermediate in organic synthesis. Safety and handling precautions should be observed, as with many brominated compounds, due to potential toxicity and environmental concerns.
Formula:C9H7BrO3
InChI:InChI=1S/C9H7BrO3/c10-7-3-1-2-6(4-7)5-8(11)9(12)13/h1-4H,5H2,(H,12,13)
InChI key:BNSGMTRQCHIFQH-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)Br)CC(=O)C(=O)O
Synonyms:
  • Benzenepropanoic acid, 3-broMo-.alpha.-oxo-
  • 3-Bromo-a-oxo-benzenepropanoic acid
  • Benzenepropanoic acid, 3-bromo-α-oxo-
Found 5 products.