CAS 208245-60-7
:1-Piperidinecarboxylic acid, 4-cyclopropyl-, 1,1-dimethylethyl ester
Description:
1-Piperidinecarboxylic acid, 4-cyclopropyl-, 1,1-dimethylethyl ester, identified by CAS number 208245-60-7, is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a cyclopropyl group at the 4-position of the piperidine ring, contributing to its unique steric and electronic properties. The presence of the 1,1-dimethylethyl ester functional group indicates that it has a branched alkyl chain, which can influence its solubility and reactivity. Generally, esters are known for their pleasant odors and are often used in flavoring and fragrance applications. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and overall molecular structure. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C13H23NO2
InChI:InChI=1S/C13H23NO2/c1-13(2,3)16-12(15)14-8-6-11(7-9-14)10-4-5-10/h10-11H,4-9H2,1-3H3
InChI key:DDTCBHPOGWRJIZ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)C2CC2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Piperidinecarboxylic acid, 4-cyclopropyl-, 1,1-dimethylethyl ester
CAS:Formula:C13H23NO2Molecular weight:225.3272
