CymitQuimica logo

CAS 20825-90-5

:

9-Fluoro-9H-fluorene

Description:
9-Fluoro-9H-fluorene is an organic compound characterized by its unique structure, which consists of a fluorene backbone with a fluorine atom substituent at the 9-position. This compound typically appears as a white to pale yellow solid and is known for its aromatic properties due to the presence of fused benzene rings. The fluorine atom enhances its chemical reactivity and can influence its physical properties, such as solubility and boiling point. 9-Fluoro-9H-fluorene is often utilized in organic synthesis and materials science, particularly in the development of fluorinated compounds and polymers. Its reactivity can be attributed to the electron-withdrawing nature of the fluorine atom, which can affect the compound's behavior in various chemical reactions. Additionally, it may exhibit interesting photophysical properties, making it a candidate for applications in optoelectronic devices. Safety precautions should be taken when handling this compound, as with many fluorinated organic substances, due to potential toxicity and environmental concerns.
Formula:C13H9F
InChI:InChI=1S/C13H9F/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13H
InChI key:InChIKey=GWUJNUYVLNPPHK-UHFFFAOYSA-N
SMILES:FC1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:
  • Fluorene, 9-fluoro-
  • 9H-Fluorene, 9-fluoro-
  • 9-Fluoro-9H-fluorene
  • 9-Fluorofluorene
Found 1 products.