CymitQuimica logo

CAS 208264-60-2

:

ethyl 2,5-dibromothiazole-4-carboxylate

Description:
Ethyl 2,5-dibromothiazole-4-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features two bromine substituents at the 2 and 5 positions of the thiazole ring, contributing to its reactivity and potential biological activity. The presence of the ethyl ester group at the 4-position enhances its solubility in organic solvents and may influence its pharmacokinetic properties. Ethyl 2,5-dibromothiazole-4-carboxylate is often studied for its potential applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals due to the biological activity associated with thiazole derivatives. Its molecular structure allows for various chemical modifications, which can lead to the synthesis of derivatives with enhanced properties. As with many brominated compounds, it is essential to consider environmental and safety aspects during handling and disposal.
Formula:C6H5Br2NO2S
InChI:InChI=1/C6H5Br2NO2S/c1-2-11-5(10)3-4(7)12-6(8)9-3/h2H2,1H3
InChI key:SAEIBOLCDWLABF-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c(Br)sc(Br)n1
Synonyms:
  • 4-Thiazolecarboxylic acid, 2,5-dibromo-, ethyl ester
  • Ethyl 2,5-dibromo-1,3-thiazole-4-carboxylate
Found 4 products.