CAS 20839-34-3

cis-5-eicosenoic acid methyl ester

Description:

Cis-5-eicosenoic acid methyl ester, with the CAS number 20839-34-3, is a methyl ester derived from eicosenoic acid, a long-chain unsaturated fatty acid. This compound features a cis configuration at the fifth carbon of its carbon chain, which contributes to its unique physical and chemical properties. It is typically a colorless to pale yellow liquid at room temperature, exhibiting low volatility and a relatively high boiling point due to its long hydrocarbon chain. The presence of a double bond in the cis configuration influences its reactivity, making it more susceptible to oxidation compared to saturated fatty acids. This compound is soluble in organic solvents but has limited solubility in water, characteristic of many fatty acid esters. It is often studied for its potential applications in biodiesel production, as well as in the synthesis of various bioactive compounds. Additionally, its structural features make it relevant in the fields of biochemistry and nutrition, particularly in the study of fatty acid metabolism and health effects.

Formula: C₂₁H₄₀O₂

InChI: InChI=1S/C21H40O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h16-17H,3-15,18-20H2,1-2H3

InChI key: DCELZGFMHKOOJH-UHFFFAOYSA-N

SMILES: CCCCCCCCCCCCCCC=CCCCC(=O)OC

Methyl 5(Z)-eicosenoate

CAS: 20839-34-3

Methyl 5(Z)-eicosenoate is a lipid utilized in the preparation of lipid nanoparticles (LNP) for drug delivery applications.

Formula: C₂₁H₄₀O₂

Molecular weight: 324.55

Ref: TM-TCL-02241

Methyl 5(Z)-Eicosenoate

CAS: 20839-34-3

Formula: C21H40O2

Purity: >98%

Color and Shape: Solid

Molecular weight: 324.54

Ref: 48-20-2015

5-Eicosenoic acid, methyl ester, (5Z)-

CAS: 20839-34-3

Formula: C₂₁H₄₀O₂

Molecular weight: 324.5411

Ref: IN-DA002JNS

Methyl 5(Z)-eicosenoate

CAS: 20839-34-3

Methyl 5(Z)-eicosenoate is a fatty acid ester, which is a compound often found in various plant oils. This ester is primarily sourced from the lipids of certain plant species, where it occurs naturally as part of complex lipid structures. Its mode of action involves integrating into lipid bilayers or serving as a substrate in biochemical pathways that synthesize or modify complex lipid molecules. This characteristic allows it to be a useful compound in the study of lipid metabolism and related biochemical processes.

Formula: C₂₁H₄₀O₂

Purity: Min. 95%

Molecular weight: 324.5 g/mol

Ref: 3D-VAA83934