CymitQuimica logo

CAS 208522-13-8

:

5-Hexenoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, (2S)-

Description:
5-Hexenoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, (2S)-, with the CAS number 208522-13-8, is an organic compound characterized by its unique structure that includes a hexenoic acid backbone and an amino acid derivative. This compound features a double bond in the hexenoic acid chain, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has protective groups commonly used in peptide synthesis, enhancing its utility in medicinal chemistry and biochemistry. The (2S)- configuration suggests that it has specific stereochemical properties, which can influence its biological activity and interactions. This compound is likely to be soluble in organic solvents and may exhibit moderate solubility in water due to the presence of the carboxylic acid functional group. Overall, its structural features make it a valuable intermediate in the synthesis of more complex molecules, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C11H19NO4
InChI:InChI=1S/C11H19NO4/c1-5-6-7-8(9(13)14)12-10(15)16-11(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,12,15)(H,13,14)/t8-/m0/s1
InChI key:LQIMZUPFMSNHTM-QMMMGPOBSA-N
SMILES:CC(C)(C)OC(=O)N[C@@H](CCC=C)C(=O)O
Found 5 products.