CymitQuimica logo

CAS 20878-52-8

:

Benzamide, 2-amino-N-[3-(trifluoromethyl)phenyl]-

Description:
Benzamide, 2-amino-N-[3-(trifluoromethyl)phenyl]- is an organic compound characterized by its amide functional group, which is derived from benzoic acid. The presence of the amino group (-NH2) and the trifluoromethyl group (-CF3) on the phenyl ring significantly influences its chemical properties and reactivity. This compound typically exhibits moderate solubility in polar solvents due to the ability of the amine to engage in hydrogen bonding. The trifluoromethyl group enhances lipophilicity and can impart unique electronic properties, making the compound of interest in medicinal chemistry and material science. It may also exhibit biological activity, potentially serving as a scaffold for drug development. The molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted for handling, as the trifluoromethyl group can affect toxicity and environmental impact. Overall, this compound is notable for its structural features that combine both hydrophilic and lipophilic characteristics, making it versatile in various chemical applications.
Formula:C14H11F3N2O
InChI:InChI=1S/C14H11F3N2O/c15-14(16,17)9-4-3-5-10(8-9)19-13(20)11-6-1-2-7-12(11)18/h1-8H,18H2,(H,19,20)
InChI key:OAEMTEMEJOQHES-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C(=O)NC2=CC=CC(=C2)C(F)(F)F)N
Found 2 products.