CymitQuimica logo

CAS 2088-24-6

:

3-Methoxyphenoxyacetic acid

Description:
3-Methoxyphenoxyacetic acid, with the CAS number 2088-24-6, is an organic compound characterized by its phenoxyacetic acid structure, which includes a methoxy group attached to the phenyl ring. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents, while its solubility in water is limited. It is known for its role as a plant growth regulator, influencing various physiological processes in plants. The presence of the methoxy group enhances its biological activity and stability. In terms of chemical properties, it exhibits moderate acidity due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, 3-Methoxyphenoxyacetic acid can be used in research and agricultural applications, particularly in the study of plant responses to growth regulators. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H10O4
InChI:InChI=1/C9H10O4/c1-12-7-3-2-4-8(5-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)
InChI key:AHDPQRIYMMZJTF-UHFFFAOYSA-N
SMILES:COc1cccc(c1)OCC(=O)O
Synonyms:
  • Acetic acid, (3-methoxyphenoxy)-
  • (3-Methoxyphenoxy)acetic acid
Found 5 products.