CymitQuimica logo

CAS 2089376-90-7

:

2-Thiophenecarboxylic acid, 5-bromo-4-fluoro-, ethyl ester

Description:
2-Thiophenecarboxylic acid, 5-bromo-4-fluoro-, ethyl ester is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group that is esterified with an ethyl group, enhancing its solubility and reactivity. The presence of bromine and fluorine substituents at the 5 and 4 positions, respectively, introduces significant electronic effects, influencing the compound's reactivity and potential applications in medicinal chemistry and materials science. The bromine atom can enhance the compound's lipophilicity, while the fluorine atom may improve metabolic stability. This compound is likely to exhibit interesting properties such as antimicrobial or anti-inflammatory activities, making it a candidate for further research in drug development. Additionally, its unique structure may allow for various synthetic modifications, facilitating the exploration of structure-activity relationships in related compounds. Overall, 2-Thiophenecarboxylic acid, 5-bromo-4-fluoro-, ethyl ester represents a valuable compound in the field of organic synthesis and pharmaceutical chemistry.
Formula:C7H6BrFO2S
InChI:InChI=1S/C7H6BrFO2S/c1-2-11-7(10)5-3-4(9)6(8)12-5/h3H,2H2,1H3
InChI key:MQVOXAMJIRQSGR-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC(=C(S1)Br)F
Synonyms:
  • 2-Thiophenecarboxylic acid, 5-bromo-4-fluoro-, ethyl ester
Found 2 products.