CymitQuimica logo

CAS 2091134-68-6

:

AZD-4205

Description:
AZD-4205 is a chemical compound that has garnered attention in pharmaceutical research, particularly for its potential therapeutic applications. It is classified as a selective antagonist of the orexin receptor, which plays a crucial role in regulating sleep-wake cycles and appetite. The compound's mechanism of action involves blocking the orexin receptors, thereby influencing neurobiological pathways associated with sleep disorders and possibly obesity. AZD-4205 is characterized by its specific binding affinity to the orexin receptors, which distinguishes it from other compounds in the same class. Its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, are essential for determining its efficacy and safety profile in clinical settings. Ongoing studies aim to evaluate its therapeutic potential, side effects, and overall impact on conditions like insomnia and other sleep-related disorders. As research progresses, AZD-4205 may contribute to the development of new treatments that target orexin signaling pathways.
Formula:C25H31N9O2
InChI:InChI=1S/C25H31N9O2/c1-16(34-12-10-32(2)11-13-34)23(35)28-20-7-5-6-17-18(14-27-22(17)20)19-8-9-26-25(29-19)30-21-15-33(3)31-24(21)36-4/h5-9,14-16,27H,10-13H2,1-4H3,(H,28,35)(H,26,29,30)/t16-/m1/s1
InChI key:CVCVOSPZEVINRM-MRXNPFEDSA-N
SMILES:C[C@H](C(=O)NC1=CC=CC2=C1NC=C2C3=NC(=NC=C3)NC4=CN(N=C4OC)C)N5CCN(CC5)C
Found 6 products.