CAS 20913-18-2

Formula: C11H14N2O4

InChI: InChI=1S/C11H14N2O4/c1-7-8(12-10(14)16-2)5-4-6-9(7)13-11(15)17-3/h4-6H,1-3H3,(H,12,14)(H,13,15)

InChI key: JNNLWOJZIPJIQG-UHFFFAOYSA-N

SMILES: CC1=C(C=CC=C1NC(=O)OC)NC(=O)OC

Dimethyl (2-methyl-1,3-phenylene)dicarbamate

CAS: 20913-18-2

Dimethyl (2-methyl-1,3-phenylene)dicarbamate

Formula: C₁₁H₁₄N₂O₄

Purity: 98%

Molecular weight: 238.24

Ref: 54-OR1063663

Carbamic acid, N,N'-(2-methyl-1,3-phenylene)bis-, C,C'-dimethyl ester

CAS: 20913-18-2

Formula: C₁₁H₁₄N₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 238.2399

Ref: IN-DA002K2A

Obtucarbamate B

CAS: 20913-18-2

Formula: C₁₁H₁₄N₂O₄

Purity: 95%~99%

Molecular weight: 238.243

Ref: BP-SBP02742

Obtucarbamate B

CAS: 20913-18-2

Obtucarbamate B is a naturally occurring bioactive compound, belonging to the class of carbamate derivatives. It is isolated from certain plant sources renowned for their secondary metabolites with therapeutic potential. The mode of action of Obtucarbamate B involves the selective inhibition of specific enzymatic functions, which can interfere with various biochemical pathways fundamental to cellular processes.

Formula: C₁₁H₁₄N₂O₄

Purity: Min. 95%

Molecular weight: 238.24 g/mol

Ref: 3D-VAA91318