CymitQuimica logo

CAS 209256-40-6

:

2,3-dihydro-1-benzofuran-4-carboxylic acid

Description:
2,3-Dihydro-1-benzofuran-4-carboxylic acid is an organic compound characterized by its bicyclic structure, which consists of a benzofuran moiety with a carboxylic acid functional group. This compound features a fused ring system that contributes to its unique chemical properties. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound may exhibit moderate stability under standard conditions but can be sensitive to heat and light, which may lead to degradation. Its chemical reactivity is influenced by the functional groups present, allowing for potential participation in various organic reactions, such as esterification or amidation. Additionally, 2,3-dihydro-1-benzofuran-4-carboxylic acid may possess biological activity, making it of interest in medicinal chemistry and drug development. As with any chemical substance, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C9H8O3
InChI:InChI=1/C9H8O3/c10-9(11)7-2-1-3-8-6(7)4-5-12-8/h1-3H,4-5H2,(H,10,11)
InChI key:CHDSHBWEGSCEDX-UHFFFAOYSA-N
SMILES:c1cc(c2CCOc2c1)C(=O)O
Synonyms:
  • 4-Benzofurancarboxylic Acid, 2,3-Dihydro-
  • 2,3-Dihydro-1-benzofuran-4-carboxylic acid
  • 2,3-Dihydrobenzo[b]furan-4-carboxylic acid
  • 2,3-dihydrobenzofuran-4-carboxylic acid
  • 2,3-Dihydro-4-benzofurancarboxylic Acid
  • 2,3 dihdyrobenzofuran 4 carboxylic acid
Found 2 products.