CymitQuimica logo

CAS 209256-42-8

:

2,3-Dihydro-1-benzofuran-4-carbaldehyde

Description:
2,3-Dihydro-1-benzofuran-4-carbaldehyde is an organic compound characterized by its unique bicyclic structure, which combines a benzofuran moiety with an aldehyde functional group. This compound features a fused benzene and furan ring, contributing to its aromatic properties and potential reactivity. The presence of the aldehyde group (-CHO) makes it a versatile intermediate in organic synthesis, allowing for various chemical transformations, such as oxidation and condensation reactions. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The compound is of interest in medicinal chemistry and materials science due to its potential biological activities and applications in the synthesis of more complex molecules. As with many organic compounds, it should be handled with care, observing appropriate safety protocols to mitigate any risks associated with its use. Its solubility and stability can vary based on the solvent and environmental conditions, making it important to consider these factors in practical applications.
Formula:C9H8O2
InChI:InChI=1/C9H8O2/c10-6-7-2-1-3-9-8(7)4-5-11-9/h1-3,6H,4-5H2
InChI key:MKWRRGVTYBMERJ-UHFFFAOYSA-N
SMILES:c1cc(C=O)c2CCOc2c1
Synonyms:
  • 2,3-Dihydro-benzofuran-4-carbaldehyde
  • 4-Benzofurancarboxaldehyde, 2,3-Dihydro-
  • 2,3-dihydro-4-Benzofurancarboxaldehyde
Found 5 products.