CAS 2094-72-6
:1-Adamantanecarbonyl chloride
Description:
1-Adamantanecarbonyl chloride, with the CAS number 2094-72-6, is an organic compound characterized by its unique adamantane structure, which consists of a fused polycyclic framework. This compound features a carbonyl group (C=O) attached to an adamantane moiety, making it a derivative of adamantane. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the carbonyl chloride functional group indicates that it is a reactive acyl chloride, which can participate in various chemical reactions, such as nucleophilic acyl substitution. This reactivity makes it useful in organic synthesis, particularly in the formation of amides and esters. 1-Adamantanecarbonyl chloride is also known for its relatively high stability under standard conditions, although it should be handled with care due to its potential reactivity with water and other nucleophiles, which can lead to the release of hydrochloric acid. Overall, its unique structure and reactivity profile make it a valuable compound in synthetic organic chemistry.
Formula:C11H15ClO
InChI:InChI=1S/C11H15ClO/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2
InChI key:InChIKey=MIBQYWIOHFTKHD-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C12CC3CC(C1)CC(C2)C3
Synonyms:- 1-Adamantane Carbonyl Chloride
- 1-Adamantanecarbonyl Chloride
- 1-Adamantanoyl chloride
- 1-Adamantoyl chloride
- 1-Adamantylcarbonyl chloride
- 1-Adamantylcarboxylic acid chloride
- 1-Chlorocarbonyladamantane
- Adamantane-1-carbonyl chloride
- NSC 179368
- NSC 249324
- Tricyclo(3.3.1.13,7)Decane-1-Carbonyl Chloride
- Tricyclo[3.3.1.1<sup>3,7</sup>]decane-1-carbonyl chloride
- Tricyclo[3.3.1.1~3,7~]Decane-1-Carbonyl Chloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Adamantanecarbonyl Chloride
CAS:Formula:C11H15ClOPurity:>97.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:198.69Adamantane-1-carbonyl chloride, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H15ClOPurity:97%Color and Shape:Crystals or powder or crystalline powder or fused or granular solid, White to pale creamMolecular weight:198.69Tricyclo[3.3.1.13,7]decane-1-carbonyl chloride
CAS:Formula:C11H15ClOPurity:97%Color and Shape:SolidMolecular weight:198.68921-Adamantanecarbonyl chloride
CAS:1-Adamantanecarbonyl chlorideFormula:C11H15ClOPurity:99%Color and Shape:SolidMolecular weight:198.6892adamantane-1-carbonyl chloride
CAS:Formula:C11H15ClOPurity:98%Color and Shape:No data available.Molecular weight:198.69




