CymitQuimica logo

CAS 2106-18-5

:

2-(trifluoromethoxy)fluorobenzene

Description:
2-(Trifluoromethoxy)fluorobenzene, with the CAS number 2106-18-5, is an aromatic compound characterized by the presence of both a trifluoromethoxy group and a fluorine atom attached to a benzene ring. This compound features a fluorinated aromatic system, which contributes to its unique chemical properties, including increased electronegativity and potential reactivity. The trifluoromethoxy group (-O-CF3) enhances the compound's lipophilicity and can influence its solubility in organic solvents. Additionally, the presence of multiple fluorine atoms can impart stability and resistance to degradation, making it useful in various applications, including pharmaceuticals and agrochemicals. The compound is typically colorless to pale yellow in appearance and may exhibit a distinct odor. Its physical and chemical properties, such as boiling point, melting point, and reactivity, are influenced by the electronegative fluorine atoms, which can affect intermolecular interactions. Safety precautions should be taken when handling this compound, as fluorinated compounds can pose health and environmental risks.
Formula:C7H4F4O
InChI:InChI=1/C7H4F4O/c8-5-3-1-2-4-6(5)12-7(9,10)11/h1-4H
InChI key:UKRYEFFTFFRSPY-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)F)OC(F)(F)F
Synonyms:
  • 2-Fluoro Trifluoromethoxy Benzene
  • o-Fluoro Trifluoromethoxy Benzene
  • 1-Fluoro-2-(Trifluoromethoxy)Benzene
Found 5 products.