CAS 21080-31-9

12,13-Dihydro-1,2,13-trimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridine

Description:

12,13-Dihydro-1,2,13-trimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridine, with the CAS number 21080-31-9, is a complex organic compound characterized by its unique molecular structure, which includes multiple methoxy groups and a phenanthridine core. This compound belongs to a class of alkaloids and is known for its potential biological activities, including antimicrobial and anticancer properties. Its structure features a fused benzodioxole and phenanthridine moiety, contributing to its chemical stability and reactivity. The presence of methoxy groups enhances its solubility in organic solvents and may influence its interaction with biological targets. Additionally, the compound's stereochemistry and functional groups play a crucial role in its pharmacological profile. While specific applications and detailed biological effects may vary, compounds of this nature are often studied for their therapeutic potential in medicinal chemistry. As with many complex organic molecules, further research is necessary to fully elucidate its properties and potential uses in various fields, including pharmaceuticals and biochemistry.

Formula: C₂₂H₂₁NO₅

InChI: InChI=1S/C22H21NO5/c1-23-20-14(6-5-12-9-17-18(10-15(12)20)28-11-27-17)13-7-8-16(24-2)21(25-3)19(13)22(23)26-4/h5-10,22H,11H2,1-4H3

InChI key: InChIKey=LVWAKZBZWYHYCJ-UHFFFAOYSA-N

SMILES: O(C)C1C=2C(C3=C(N1C)C=4C(C=C3)=CC5=C(C4)OCO5)=CC=C(OC)C2OC

Synonyms:

• 12,13-Dihydro-1,2,13-trimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridine
• Angoline
• [1,3]Benzodioxolo[5,6-c]phenanthridine, 12,13-dihydro-1,2,13-trimethoxy-12-methyl-

Angoline

CAS: 21080-31-9

Angoline

Formula: C₂₂H₂₁NO₅

Purity: ≥95%

Molecular weight: 379.41

Ref: 54-BUP02990

6-Methoxyldihydrochelerythrine

CAS: 21080-31-9

Formula: C₂₂H₂₁NO₅

Molecular weight: 379.41

Ref: 7W-GY7400

6-Methoxyldihydrochelerythrine

CAS: 21080-31-9

Formula: C₂₂H₂₁NO₅

Purity: 95%~99%

Molecular weight: 379.412

Ref: BP-BP2133

1,2,13-Trimethoxy-12-methyl-12,13-dihydro-[1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridine

CAS: 21080-31-9

Formula: C₂₂H₂₁NO₅

Purity: 99.96%

Molecular weight: 379.4058

Ref: IN-DA002KZR

Angoline

CAS: 21080-31-9

Angoline hydrochloride: IL6/STAT3 inhibitor, IC50: 11.56 μM, blocks STAT3 phosphorylation and cancer cell growth.

Formula: C₂₂H₂₁NO₅

Purity: 99.43% - 99.96%

Color and Shape: Solid

Molecular weight: 379.4058

Ref: TM-TN6739

Angoline

CAS: 21080-31-9

Angoline is a benzylisoquinoline alkaloid, which is derived from natural sources such as certain plant species. Its mode of action primarily involves the modulation of biological pathways, which may include interactions with enzymes or receptors involved in inflammation and cell signaling processes. As an alkaloid, it potentially exhibits a range of bioactive properties, making it of interest for research into therapeutic applications.

Formula: C₂₂H₂₁NO₅

Purity: Min. 95%

Molecular weight: 379.4 g/mol

Ref: 3D-WAA08031