CAS 21090-30-2
:3'-O-acetylthymidine
Description:
3'-O-acetylthymidine is a modified nucleoside derivative of thymidine, characterized by the presence of an acetyl group at the 3' hydroxyl position of the sugar moiety. This modification can influence the compound's solubility, stability, and biological activity compared to unmodified thymidine. The acetyl group enhances lipophilicity, which may facilitate cellular uptake and influence interactions with enzymes and nucleic acids. 3'-O-acetylthymidine is often utilized in biochemical research and synthetic applications, particularly in the study of nucleic acid metabolism and the development of antiviral agents. Its CAS number, 21090-30-2, is a unique identifier that allows for easy reference in chemical databases. The compound's structure includes a pyrimidine base (thymine) linked to a deoxyribose sugar, making it a crucial component in DNA synthesis and function. Overall, 3'-O-acetylthymidine serves as an important tool in molecular biology and medicinal chemistry, providing insights into nucleoside behavior and potential therapeutic applications.
Formula:C12H16N2O6
InChI:InChI=1/C12H16N2O6/c1-6-4-14(12(18)13-11(6)17)10-3-8(19-7(2)16)9(5-15)20-10/h4,8-10,15H,3,5H2,1-2H3,(H,13,17,18)/t8-,9+,10+/m0/s1
Synonyms:- 1-(3-O-acetyl-2-deoxypentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione
- 3'-acetatethyMidine
- 3'-O-ACETYLTHYMIDINE
- 3'-O-acetyl-2'-deoxythyMidine
- Thymidine 3'-acetate
- 3'-ACETYLTHYMIDINE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3'-O-Acetylthymidine
CAS:3'-O-Acetylthymidine is a Nucleoside Derivative - Protected nucleoside with NH2/OH open.Formula:C12H16N2O6Color and Shape:SolidMolecular weight:284.265Ref: TM-TNU1559
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire3'-O-Acetylthymidine
CAS:(2R,3S,5R)-2-(Hydroxymethyl)-5-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3-yl acetateFormula:C12H16N2O6Purity:98%Molecular weight:284.27(2R,3S,5R)-2-(Hydroxymethyl)-5-(5-(methyl-13C)-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3-yl acetate
CAS:Controlled ProductFormula:CC11H16N2O6Color and Shape:NeatMolecular weight:285.2583'-O-Acetylthymidine
CAS:3'-O-Acetylthymidine is a dinucleoside analogue of thymidine. It has been used as a model for human immunodeficiency virus (HIV) and has been shown to be resistant to HIV infection in vitro. 3'-O-Acetylthymidine inhibits the synthesis of protein by binding to the ribosomal RNA of the host cell, preventing the formation of an aminoacyl-tRNA synthetase complex with tRNA. This prevents the incorporation of amino acids into proteins, leading to inhibition of protein synthesis and cell death. 3'-O-Acetylthymidine also inhibits HIV replication by competing with deoxycytidine triphosphate for incorporation into DNA, preventing the synthesis of viral DNA. 3'-O-Acetylthymidine is hydrolyzed by esterases or glucuronidases, oxidized by cytochrome P450 enzymes, reduced by glutathione reductaseFormula:C12H16N2O6Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:284.27 g/mol







