CymitQuimica logo

CAS 211366-30-2

:

1,5-Naphthalenedisulfonic acid, hydrate (1:4)

Description:
1,5-Naphthalenedisulfonic acid, hydrate (1:4), with the CAS number 211366-30-2, is an organic compound characterized by the presence of two sulfonic acid groups attached to a naphthalene ring at the 1 and 5 positions. This compound typically appears as a crystalline solid and is soluble in water due to the hydrophilic nature of the sulfonic acid groups. The hydrate form indicates that it contains water molecules in its structure, which can influence its physical properties and stability. 1,5-Naphthalenedisulfonic acid is often used in various applications, including as a dye intermediate, in the synthesis of other organic compounds, and in the formulation of certain industrial products. Its sulfonic acid groups contribute to its acidity and reactivity, making it useful in chemical reactions and processes. Additionally, the compound's structure allows for potential interactions with other molecules, which can be exploited in various chemical applications. Safety data should be consulted for handling and usage guidelines, as with any chemical substance.
Formula:C10H8O6S2·4H2O
InChI:InChI=1S/C10H8O6S2.4H2O/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;;;;/h1-6H,(H,11,12,13)(H,14,15,16);4*1H2
InChI key:InChIKey=ZLBLYGIIADHDKG-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C2=C(C(S(=O)(=O)O)=CC=C2)C=CC1.O
Synonyms:
  • 1,5-Naphthalenedisulfonic acid, hydrate (1:4)
  • 1,5-Naphthalenedisulfonic acid, tetrahydrate
Found 6 products.