CAS 211366-30-2
:1,5-Naphthalenedisulfonic acid, hydrate (1:4)
Description:
1,5-Naphthalenedisulfonic acid, hydrate (1:4), with the CAS number 211366-30-2, is an organic compound characterized by the presence of two sulfonic acid groups attached to a naphthalene ring at the 1 and 5 positions. This compound typically appears as a crystalline solid and is soluble in water due to the hydrophilic nature of the sulfonic acid groups. The hydrate form indicates that it contains water molecules in its structure, which can influence its physical properties and stability. 1,5-Naphthalenedisulfonic acid is often used in various applications, including as a dye intermediate, in the synthesis of other organic compounds, and in the formulation of certain industrial products. Its sulfonic acid groups contribute to its acidity and reactivity, making it useful in chemical reactions and processes. Additionally, the compound's structure allows for potential interactions with other molecules, which can be exploited in various chemical applications. Safety data should be consulted for handling and usage guidelines, as with any chemical substance.
Formula:C10H8O6S2·4H2O
InChI:InChI=1S/C10H8O6S2.4H2O/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;;;;/h1-6H,(H,11,12,13)(H,14,15,16);4*1H2
InChI key:InChIKey=ZLBLYGIIADHDKG-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C2=C(C(S(=O)(=O)O)=CC=C2)C=CC1.O
Synonyms:- 1,5-Naphthalenedisulfonic acid, hydrate (1:4)
- 1,5-Naphthalenedisulfonic acid, tetrahydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,5-Naphthalenedisulfonic Acid Tetrahydrate
CAS:Formula:C10H8O6S2·4H2OPurity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:360.35Naphthalene-1,5-disulphonic acid tetrahydrate
CAS:Naphthalene-1,5-disulphonic acid tetrahydrateFormula:C10H8O6S2·4H2OPurity:98%Color and Shape:White-pale yellow SolidMolecular weight:360.358041,5-Naphthalenedisulfonic acid, hydrate (1:4)
CAS:Formula:C10H16O10S2Purity:96%Color and Shape:SolidMolecular weight:360.35801,5-Naphthalenedisulfonic acid tetrahydrate
CAS:1,5-Naphthalenedisulfonic acid tetrahydrate is an acidic molecule that has been observed in the form of nanodots. It has a molecular weight of 212.2g/mol and a water solubility of 0.01g/L at 20°C. 1,5-Naphthalenedisulfonic acid tetrahydrate is soluble in ethanol and methanol, but insoluble in acetone, diethyl ether, ethyl acetate, and chloroform. 1,5-Naphthalenedisulfonic acid tetrahydrate is a hydrogen bond acceptor and donor in its interactions with other molecules. It interacts synergistically with 3,5-dinitrosalicylic acid to produce a red coloration when dissolved in water or alcohols.Formula:C10H6(SO3H)2•(H2O)4Purity:Min. 95%Color and Shape:PowderMolecular weight:360.36 g/mol1,5-Naphthalenedisulfonic acid tetrahydrate
CAS:Formula:C10H16O10S2Purity:96%Color and Shape:White to very pale yellow powderMolecular weight:360.35




