CAS 211439-12-2
:L-Glutamine,L-asparaginyl-L-alanyl-L-prolyl-L-valyl-L-seryl-L-isoleucyl-L-prolyl-
Description:
The chemical substance with the name "L-Glutamine, L-asparaginyl-L-alanyl-L-prolyl-L-valyl-L-seryl-L-isoleucyl-L-prolyl-" and CAS number 211439-12-2 is a peptide composed of multiple amino acids, specifically L-glutamine and several other L-amino acids. This compound is characterized by its structure, which includes a sequence of amino acids linked by peptide bonds, contributing to its potential biological activity. Peptides like this one can play significant roles in various physiological processes, including protein synthesis, cellular signaling, and metabolic regulation. The presence of multiple L-amino acids suggests that this peptide may exhibit specific conformational properties, influencing its stability and interactions with biological targets. Additionally, the sequence of amino acids can determine the peptide's solubility, reactivity, and overall functionality in biological systems. Such compounds are often studied for their therapeutic potential, including applications in nutrition, medicine, and biochemistry. However, detailed studies would be necessary to fully understand its specific properties and potential uses.
Formula:C36H60N10O12
InChI:InChI=1S/C36H60N10O12/c1-6-18(4)28(35(56)46-14-8-9-23(46)31(52)41-21(36(57)58)11-12-25(38)48)44-30(51)22(16-47)42-33(54)27(17(2)3)43-32(53)24-10-7-13-45(24)34(55)19(5)40-29(50)20(37)15-26(39)49/h17-24,27-28,47H,6-16,37H2,1-5H3,(H2,38,48)(H2,39,49)(H,40,50)(H,41,52)(H,42,54)(H,43,53)(H,44,51)(H,57,58)/t18-,19-,20-,21-,22-,23-,24-,27-,28-/m0/s1
InChI key:DWLTUUXCVGVRAV-XWRHUKJGSA-N
SMILES:CC[C@H](C)[C@@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@H](C)NC(=O)[C@H](CC(=O)N)N
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
L-Asparaginyl-L-alanyl-L-prolyl-L-valyl-L-seryl-L-isoleucyl-L-prolyl-L-glutamine
CAS:Formula:C36H60N10O12Purity:97%Color and Shape:SolidMolecular weight:824.9214Davunetide
CAS:Davunetide: neuroprotective 8-amino acid peptide, improves daily function in schizophrenia, boosts memory in mild cognitive impairment.Formula:C36H60N10O12Purity:98%Color and Shape:SolidMolecular weight:824.92NAP
CAS:NAP is a neuroprotective peptide, which is derived from activity-dependent neuroprotective protein (ADNP), with a mechanism involving microtubule stabilization and neuronal protection. It exhibits the ability to protect neurons from various types of damage, including oxidative stress and conditions mimicking neurodegenerative diseases. NAP enhances axonal transport and increases the resilience of neurons to insults that would typically result in cell death. This peptide has shown promise in preclinical studies for its potential to halt or reverse cognitive decline, making it a focal point for research into therapeutic strategies for disorders like Alzheimer's disease and other tauopathies. The peptide operates by binding to microtubules, promoting stability, and facilitating efficient transport of cellular components. Studies have highlighted its role in traversing the blood-brain barrier, which makes it a viable candidate for central nervous system-targeted therapies. Researchers continue to explore its efficacy and possible applications in improving cognitive function and providing neuroprotection in aging populations.Purity:(Hplc-Ms) Min. 98 Area-%



