CymitQuimica logo

CAS 21218-94-0

:

Benzoic acid, 4-phenoxy-, methyl ester

Description:
Benzoic acid, 4-phenoxy-, methyl ester, also known as methyl 4-phenoxybenzoate, is an organic compound characterized by its ester functional group derived from benzoic acid and phenol. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. This compound is known for its aromatic properties due to the presence of the phenoxy group, which contributes to its potential applications in the fragrance and flavor industries. It is moderately soluble in organic solvents and exhibits low solubility in water. The compound may also possess antimicrobial properties, making it of interest in various industrial applications, including as a preservative. Its chemical structure allows for potential reactivity in various organic synthesis processes, making it a valuable intermediate in the production of other chemical compounds. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C14H12O3
InChI:InChI=1S/C14H12O3/c1-16-14(15)11-7-9-13(10-8-11)17-12-5-3-2-4-6-12/h2-10H,1H3
InChI key:XMXLYEKPSHVLKD-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC=C(C=C1)OC2=CC=CC=C2
Found 4 products.