CAS 2122-63-6
:4-Amino-3-iodobenzoic acid
Description:
4-Amino-3-iodobenzoic acid, with the CAS number 2122-63-6, is an organic compound that features both amino and carboxylic acid functional groups, making it an amino acid derivative. It is characterized by the presence of an iodine atom at the meta position relative to the amino group on the benzene ring. This compound typically appears as a crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The amino group contributes to its basicity, while the carboxylic acid group imparts acidic properties. 4-Amino-3-iodobenzoic acid is often used in various chemical syntheses and can serve as an intermediate in the production of pharmaceuticals and dyes. Its reactivity can be influenced by the presence of the iodine substituent, which can participate in electrophilic aromatic substitution reactions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and research applications. Proper handling and storage are essential due to its potential reactivity and biological effects.
Formula:C7H6INO2
InChI:InChI=1S/C7H6INO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,9H2,(H,10,11)
InChI key:InChIKey=FPLDDZRJTOXFCB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(I)=C(N)C=C1
Synonyms:- 3-Iodo-4-aminobenzoic acid
- Benzoic Acid, 4-Amino-3-Iodo-
- NSC 85381
- 4-Amino-3-iodobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Amino-3-iodobenzoic Acid
CAS:Formula:C7H6INO2Purity:>98.0%(T)Color and Shape:White - Yellow Solid FormMolecular weight:263.034-Amino-3-iodobenzoic acid
CAS:4-Amino-3-iodobenzoic acidFormula:C7H6INO2Purity:95%Color and Shape:Solid-PowderMolecular weight:263.032514-Amino-3-iodobenzoic acid
CAS:Formula:C7H6INO2Purity:96%Color and Shape:SolidMolecular weight:263.03254-Amino-3-iodobenzoic acid
CAS:4-Amino-3-iodobenzoic acid is a molecule that is used as a disinfectant. It has tuberculostatic activity, which means it can inhibit the growth of mycobacteria. It is also an etiological agent for tuberculosis and has been shown to have potent bactericidal activity against Mycobacterium smegmatis. This molecule is synthesized by solid-phase synthesis and can be found in animals, chlorine, and fatty acids. The structure of 4-Amino-3-iodobenzoic acid consists of two stereoisomers, one with a cis configuration and one with a trans configuration. 4-Amino-3-iodobenzoic acid has been shown to inhibit protein synthesis in bacteria through the inhibition of RNA polymerase.Formula:C7H6INO2Purity:Min. 95%Color and Shape:PowderMolecular weight:263.03 g/mol




