CAS 21265-50-9
:Ferrate(1-), [[N,N′-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, ammonium (1:1), (OC-6-21)-
Description:
Ferrate(1-) with the specified characteristics is a complex chemical compound that features a ferrate ion coordinated with a ligand derived from N,N'-ethanediylbis[N-[(carboxy)methyl]glycine]. This compound typically exhibits a negative charge due to the ferrate ion, which is a high oxidation state of iron, specifically iron(VI). The presence of carboxymethyl groups in the ligand contributes to its chelating ability, allowing it to form stable complexes with metal ions. The ammonium component indicates that the compound may exist in a salt form, enhancing its solubility in aqueous environments. Ferrates are known for their strong oxidizing properties, making them useful in various applications, including environmental remediation and as oxidizing agents in organic synthesis. The specific structural arrangement and coordination environment of the ligands can influence the compound's reactivity and stability. Overall, this ferrate complex represents a unique intersection of coordination chemistry and environmental applications, showcasing the versatility of iron-based compounds in various chemical contexts.
Formula:C10H12FeN2O8·H4N
InChI:InChI=1S/C10H16N2O8.Fe.H3N/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;1H3/q;+3;/p-3
InChI key:InChIKey=XNSQZBOCSSMHSZ-UHFFFAOYSA-K
SMILES:O=C1[O-][Fe+3]2345[N](CC(=O)[O-]2)(CC(=O)[O-]3)CC[N]4(CC(=O)[O-]5)C1.[NH4+]
Synonyms:- Ammonium (ethylenediaminetetraacetato)iron(III)
- Ammonium Ferric 2-[2-(Bis(Carboxymethyl)Amino)Ethyl-(Carboxymethyl)Amino]Acetic Acid
- Ammonium Iron(3+) 2,2',2'',2'''-(Ethane-1,2-Diyldinitrilo)Tetraacetate (1:1:1)
- Ammonium ferric ethylenediaminetetraacetate
- Ammonium iron(3+) ethylenediaminetetraacetate
- Edta ferric ammonium
- Ferrate(1-), [(ethylenedinitrilo)tetraacetato]-, ammonium
- Ferrate(1-), [[N,N′-1,2-ethanediylbis[N-(carboxymethyl)glycinato]](4-)-N,N′,O,O′,O<sup>N</sup>,O<sup>N′</sup>]-, ammonium, (OC-6-21)-
- Ferrate(1-), [[N,N′-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, ammonium (1:1), (OC-6-21)-
- Ferrate(1-), [[N,N′-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, ammonium, (OC-6-21)-
- Ferric Ammonium EDTA
- Ferric ammonium ethylenediaminetetraacetate
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ferrate(1-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, ammonium (1:1), (OC-6-21)-
CAS:Ferrate(1-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, ammonium (1:1), (OC-6-21)-Formula:C10H22FeN3O8Molecular weight:368.14EDTA ferric ammonium dihydrate, 50% aqueous solution
CAS:Please enquire for more information about EDTA ferric ammonium dihydrate, 50% aqueous solution including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C10H12FeN2O8•NH4•(H2O)2Color and Shape:Clear LiquidMolecular weight:394.09 g/mol


