CymitQuimica logo

CAS 21279-57-2

:

1-(2-Pyrimidinyl)homopiperazine

Description:
1-(2-Pyrimidinyl)homopiperazine is a chemical compound characterized by its unique structure, which includes a homopiperazine ring and a pyrimidine moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential basicity due to the presence of nitrogen atoms in both the piperazine and pyrimidine rings. It is often used in medicinal chemistry and pharmacological research due to its ability to interact with various biological targets. The presence of the pyrimidine ring may contribute to its lipophilicity and influence its solubility in organic solvents. Additionally, 1-(2-Pyrimidinyl)homopiperazine may exhibit specific reactivity patterns, making it a candidate for further functionalization or derivatization in synthetic applications. Its molecular structure allows for potential interactions with receptors or enzymes, which can be explored in drug development. As with many organic compounds, safety and handling precautions should be observed, as the biological activity and toxicity profiles can vary significantly based on the specific context of use.
Formula:C9H14N4
InChI:InChI=1/C9H14N4/c1-4-11-9(12-5-1)13-7-2-3-10-6-8-13/h1,4-5,10H,2-3,6-8H2
InChI key:InChIKey=LZOGPVCTSDAYIP-UHFFFAOYSA-N
SMILES:C=1(N=CC=CN1)N2CCCNCC2
Synonyms:
  • 1-(2-Pyrimidinyl)-1,4-diazepane
  • 1-(2-Pyrimidyl)homopiperazine
  • 1-Pyrimidin-2-Yl-1,4-Diazepane
  • 1H-1,4-Diazepine, hexahydro-1-(2-pyrimidinyl)-
  • Hexahydro-1-(2-pyrimidinyl)-1H-1,4-diazepine
  • 1-(2-Pyrimidinyl)homopiperazine
  • 1-pyrimidin-2-yl-1,4-diazepane(SALTDATA: FREE)
Found 2 products.