CAS 212838-70-5
:D-(-)-2-Chlorophenylglycine methyl ester hydrochloride
Description:
D-(-)-2-Chlorophenylglycine methyl ester hydrochloride is a chemical compound characterized by its specific structural features and properties. It is an amino acid derivative, which includes a chlorophenyl group, contributing to its unique reactivity and potential biological activity. The presence of the methyl ester group enhances its lipophilicity, facilitating its absorption and interaction in biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it suitable for various applications in pharmaceutical formulations. This compound may exhibit chiral properties, with the D-(-) designation indicating its specific stereochemistry, which can influence its pharmacological effects. It is often studied for its potential roles in medicinal chemistry, particularly in the development of drugs targeting specific receptors or pathways. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, D-(-)-2-Chlorophenylglycine methyl ester hydrochloride is a compound of interest in both research and application within the field of chemistry and pharmacology.
Formula:C9H11Cl2NO2
InChI:InChI=1S/C9H10ClNO2.ClH/c1-13-9(12)8(11)6-4-2-3-5-7(6)10;/h2-5,8H,11H2,1H3;1H/t8-;/m1./s1
InChI key:SUUNIMMHDPICBD-DDWIOCJRSA-N
SMILES:COC(=O)[C@@H](C1=CC=CC=C1Cl)N.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Methyl 2-chloro-β-D-phenylalanine (methyl (R)-2-amino-2-(2-chlorophenyl)acetate, hydrochloride)
CAS:Aromatic amino-acids and their esters, other than those containing more than one kind of oxygen function, nesoiFormula:C9H10ClNO2·HClColor and Shape:White Off-White SolidMolecular weight:235.01668(R)-Methyl 2-amino-2-(2-chlorophenyl)acetate hydrochloride
CAS:Formula:C9H11Cl2NO2Purity:97%Color and Shape:SolidMolecular weight:236.0951(R)-methyl 2-amino-2-(2-chlorophenyl)acetate hydrochloride (Clopidogrel Impurity)
CAS:(R)-methyl 2-amino-2-(2-chlorophenyl)acetate hydrochloride (Clopidogrel Impurity)Formula:C9H11Cl2NO2Purity:98%Molecular weight:236.1Clopidogrel Impurity 5 HCl
CAS:Formula:C9H10ClNO2·HClColor and Shape:White To Off-White SolidMolecular weight:199.64 36.46(R)-Methyl 2-amino-2-(2-chlorophenyl)acetate hydrochloride
CAS:(R)-Methyl 2-amino-2-(2-chlorophenyl)acetate hydrochlorideFormula:C9H11Cl2NO2Purity:98%Molecular weight:236.1(R)-(-)-2-Chlorophenylglycine Methyl Ester Hydrochloride
CAS:Controlled ProductApplications (R)-(-)-2-Chlorophenylglycine Methyl Ester Hydrochloride
Formula:C9H11Cl2NO2Color and Shape:NeatMolecular weight:236.1D-(-)-2-Chlorophenylglycine methyl ester hydrochloride
CAS:Please enquire for more information about D-(-)-2-Chlorophenylglycine methyl ester hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C9H10ClNO2•HClPurity:Min. 95%Molecular weight:236.1 g/mol(R)-METHYL 2-AMINO-2-(2-CHLOROPHENYL)ACETATE HYDROCHLORIDE
CAS:Purity:97%Molecular weight:236.0899963








