CAS 21320-91-2
:2-Methoxy-4-nitrobenzenesulfonyl chloride
Description:
2-Methoxy-4-nitrobenzenesulfonyl chloride, with the CAS number 21320-91-2, is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions. This compound features a methoxy group and a nitro group positioned on a benzene ring, contributing to its unique chemical properties. It is typically a yellow to brown solid or liquid, depending on its purity and form. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to participate in nucleophilic substitution reactions, which are valuable in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. Additionally, the nitro group can influence the compound's reactivity and stability, while the methoxy group can affect its solubility and electronic properties. Due to its reactive nature, appropriate safety precautions should be taken when handling this compound, as it can be corrosive and harmful upon contact with skin or inhalation.
Formula:C7H6ClNO5S
InChI:InChI=1S/C7H6ClNO5S/c1-14-6-4-5(9(10)11)2-3-7(6)15(8,12)13/h2-4H,1H3
InChI key:InChIKey=QECYXMKYZQXEHM-UHFFFAOYSA-N
SMILES:O(C)C1=C(S(Cl)(=O)=O)C=CC(N(=O)=O)=C1
Synonyms:- 2-Methoxy-4-nitrobenzene-1-sulfonyl chloride
- 2-Methoxy-4-nitrobenzenesulphonyl chloride
- 4-Nitro-2-methoxybenzenesulfonyl chloride
- Benzenesulfonyl chloride, 2-methoxy-4-nitro-
- NSC 211731
- 2-Methoxy-4-nitrobenzenesulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Methoxy-4-nitrobenzenesulfonyl Chloride
CAS:Formula:C7H6ClNO5SPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:251.642-Methoxy-4-nitrobenzenesulfonyl chloride, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H6ClNO5SPurity:97%Color and Shape:Crystals or powder or crystalline powder or fused solid, Cream to yellow to brownMolecular weight:251.642-Methoxy-4-nitrobenzenesulphonyl chloride
CAS:2-Methoxy-4-nitrobenzenesulphonyl chlorideFormula:C7H6ClNO5SPurity:95%Color and Shape:SolidMolecular weight:251.644242-Methoxy-4-nitrobenzene-1-sulfonyl chloride
CAS:Formula:C7H6ClNO5SPurity:96%Color and Shape:SolidMolecular weight:251.64422-Methoxy-4-nitrobenzenesulfonyl chloride
CAS:Formula:C7H6ClNO5SPurity:96%Color and Shape:SolidMolecular weight:251.64




