CymitQuimica logo

CAS 21320-91-2

:

2-Methoxy-4-nitrobenzenesulfonyl chloride

Description:
2-Methoxy-4-nitrobenzenesulfonyl chloride, with the CAS number 21320-91-2, is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions. This compound features a methoxy group and a nitro group positioned on a benzene ring, contributing to its unique chemical properties. It is typically a yellow to brown solid or liquid, depending on its purity and form. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to participate in nucleophilic substitution reactions, which are valuable in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. Additionally, the nitro group can influence the compound's reactivity and stability, while the methoxy group can affect its solubility and electronic properties. Due to its reactive nature, appropriate safety precautions should be taken when handling this compound, as it can be corrosive and harmful upon contact with skin or inhalation.
Formula:C7H6ClNO5S
InChI:InChI=1S/C7H6ClNO5S/c1-14-6-4-5(9(10)11)2-3-7(6)15(8,12)13/h2-4H,1H3
InChI key:InChIKey=QECYXMKYZQXEHM-UHFFFAOYSA-N
SMILES:O(C)C1=C(S(Cl)(=O)=O)C=CC(N(=O)=O)=C1
Synonyms:
  • 2-Methoxy-4-nitrobenzene-1-sulfonyl chloride
  • 2-Methoxy-4-nitrobenzenesulphonyl chloride
  • 4-Nitro-2-methoxybenzenesulfonyl chloride
  • Benzenesulfonyl chloride, 2-methoxy-4-nitro-
  • NSC 211731
  • 2-Methoxy-4-nitrobenzenesulfonyl chloride
Found 6 products.