CAS 213743-31-8: 7-cyclopentyl-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Description:7-Cyclopentyl-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrrolo[2,3-d]pyrimidine core. This compound features a cyclopentyl group and a phenoxyphenyl substituent, contributing to its unique chemical properties and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can influence its behavior in biological systems. The compound may act as a kinase inhibitor or have other pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, which can be explored in drug development. As with many synthetic compounds, its stability, reactivity, and interactions with other molecules are crucial for understanding its potential applications in pharmaceuticals or other fields. Safety and handling precautions should be observed due to its chemical nature.
Formula:C23H22N4O
InChI:InChI=1S/C23H22N4O/c24-22-21-20(14-27(17-6-4-5-7-17)23(21)26-15-25-22)16-10-12-19(13-11-16)28-18-8-2-1-3-9-18/h1-3,8-15,17H,4-7H2,(H2,24,25,26)
InChI key:InChIKey=FMETVQKSDIOGPX-UHFFFAOYSA-N
SMILES:N=1C=NC2=C(C1N)C(=CN2C3CCCC3)C=4C=CC(OC=5C=CC=CC5)=CC4
- Synonyms:
- 7-Cyclopentyl-5-(4-phenoxy)phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ylamine
- 7H-pyrrolo[2,3-d]pyrimidin-4-amine, 7-cyclopentyl-5-(4-phenoxyphenyl)-
- Kin 001-51
- Rk 24466
- 7-Cyclopentyl-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine