CAS 213743-31-8
:7-cyclopentyl-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Description:
7-Cyclopentyl-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrrolo[2,3-d]pyrimidine core. This compound features a cyclopentyl group and a phenoxyphenyl substituent, contributing to its unique chemical properties and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can influence its behavior in biological systems. The compound may act as a kinase inhibitor or have other pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, which can be explored in drug development. As with many synthetic compounds, its stability, reactivity, and interactions with other molecules are crucial for understanding its potential applications in pharmaceuticals or other fields. Safety and handling precautions should be observed due to its chemical nature.
Formula:C23H22N4O
InChI:InChI=1/C23H22N4O/c24-22-21-20(14-27(17-6-4-5-7-17)23(21)26-15-25-22)16-10-12-19(13-11-16)28-18-8-2-1-3-9-18/h1-3,8-15,17H,4-7H2,(H2,24,25,26)
InChI key:InChIKey=FMETVQKSDIOGPX-UHFFFAOYSA-N
SMILES:NC1=C2C(=CN(C2=NC=N1)C3CCCC3)C4=CC=C(OC5=CC=CC=C5)C=C4
Synonyms:- 7-Cyclopentyl-5-(4-phenoxy)phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ylamine
- 7H-pyrrolo[2,3-d]pyrimidin-4-amine, 7-cyclopentyl-5-(4-phenoxyphenyl)-
- Kin 001-51
- Rk 24466
- 7-Cyclopentyl-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine
- RK-24466 ;RK 24466 ;RK24466
- d]pyrimidin-4-ylamine
- Lck Inhibitor - CAS 213743-31-8 - Calbiochem
- 7-Cyclopentyl-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3‑:d]pyrimidin-4-ylamine
- 7-CYCLOPENTYL-5-(4-PHENOXY)PHENYL-7H-PYR
- 7-Cyclopentyl-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3‑
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
RK-24466
CAS:7-Cyclopentyl-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amineFormula:C23H22N4OPurity:99%Molecular weight:370.457-Cyclopentyl-5-(4-phenoxyphenyl)-7h-pyrrolo[2,3-d]pyrimidin-4-ylamine
CAS:Formula:C23H22N4OPurity:98%Color and Shape:SolidMolecular weight:370.44707-Cyclopentyl-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-ylamine
CAS:Formula:C23H22N4OMolecular weight:370.45RK-24466
CAS:RK-24466 (KIN 001-51) is a selective and potent inhibitor of Lck, inhibits Lck (64-509) and LckCD isoforms with IC50s of less than 1 and 2 nM, respectively.Formula:C23H22N4OPurity:98.07%Color and Shape:SolidMolecular weight:370.45Ref: TM-T16760
1mg63.00€5mg137.00€1mL*10mM (DMSO)150.00€10mg215.00€25mg371.00€50mg557.00€100mg858.00€Lck Inhibitor
CAS:Lck inhibitor is a small-molecule drug that inhibits the enzyme Lck, which is a tyrosine kinase. It has been shown to be effective in reducing inflammation and preventing the formation of atherosclerotic plaques by inhibiting the activation of cells that promote inflammation and the production of inflammatory mediators. Dasatinib has also been shown to inhibit human CD4+ T-cells, hydrogen bond formation, and kinase selectivity. This drug is selective for Lck over other tyrosine kinases, such as Bcr/Abl or Src family members. Dasatinib can be used for sample preparation before analysis with flow cytometry or immunohistochemistry because it does not interfere with these techniques. This drug is rapidly absorbed from the gastrointestinal tract after oral administration and excreted via urine. The pharmacokinetic properties of this drug are similar in humans and mice.Formula:C23H22N4OPurity:Min. 95%Molecular weight:370.45 g/mol






